C12H9F3N2 — CID 114217557
N-[(2,3-difluorophenyl)methyl]-5-fluoropyridin-3-amine (PubChem CID 114217557) has the molecular formula C12H9F3N2 and a molecular weight of 238.21 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methyl]-5-fluoropyridin-3-amine.
| Compound Name | N-[(2,3-difluorophenyl)methyl]-5-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 114217557 |
| Molecular Formula | C12H9F3N2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | N-[(2,3-difluorophenyl)methyl]-5-fluoropyridin-3-amine |
| SMILES | Fc1cncc(NCc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C12H9F3N2/c13-9-4-10(7-16-6-9)17-5-8-2-1-3-11(14)12(8)15/h1-4,6-7,17H,5H2 |
| InChIKey | CLHWZTVENNCNDB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |