C17H14F2N2 — CID 63667721
N-[(2,3-difluorophenyl)methyl]-3-pyrrol-1-ylaniline (PubChem CID 63667721) has the molecular formula C17H14F2N2 and a molecular weight of 284.31 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methyl]-3-pyrrol-1-ylaniline.
| Compound Name | N-[(2,3-difluorophenyl)methyl]-3-pyrrol-1-ylaniline |
|---|---|
| PubChem CID | 63667721 |
| Molecular Formula | C17H14F2N2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-[(2,3-difluorophenyl)methyl]-3-pyrrol-1-ylaniline |
| SMILES | Fc1cccc(CNc2cccc(-n3cccc3)c2)c1F |
| InChI | InChI=1S/C17H14F2N2/c18-16-8-3-5-13(17(16)19)12-20-14-6-4-7-15(11-14)21-9-1-2-10-21/h1-11,20H,12H2 |
| InChIKey | LNBHDIMIPGTCEF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |