C13H13FN2O — CID 113342955
5-fluoro-N-[(2-methoxyphenyl)methyl]pyridin-3-amine (PubChem CID 113342955) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 5-fluoro-N-[(2-methoxyphenyl)methyl]pyridin-3-amine.
| Compound Name | 5-fluoro-N-[(2-methoxyphenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 113342955 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-fluoro-N-[(2-methoxyphenyl)methyl]pyridin-3-amine |
| SMILES | COc1ccccc1CNc1cncc(F)c1 |
| InChI | InChI=1S/C13H13FN2O/c1-17-13-5-3-2-4-10(13)7-16-12-6-11(14)8-15-9-12/h2-6,8-9,16H,7H2,1H3 |
| InChIKey | YGBXSMPYBYVMGK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |