C13H12F2N2O2S — CID 63668057
N-[(2,3-difluorophenyl)methyl]-6-methylsulfonylpyridin-3-amine (PubChem CID 63668057) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methyl]-6-methylsulfonylpyridin-3-amine.
| Compound Name | N-[(2,3-difluorophenyl)methyl]-6-methylsulfonylpyridin-3-amine |
|---|---|
| PubChem CID | 63668057 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-[(2,3-difluorophenyl)methyl]-6-methylsulfonylpyridin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(NCc2cccc(F)c2F)cn1 |
| InChI | InChI=1S/C13H12F2N2O2S/c1-20(18,19)12-6-5-10(8-17-12)16-7-9-3-2-4-11(14)13(9)15/h2-6,8,16H,7H2,1H3 |
| InChIKey | GONZCWRNSOAPOQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |