About 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine
6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine (PubChem CID 62473129) has the molecular formula C14H19N3O2S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine |
| PubChem CID | 62473129 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine |
| SMILES | Cc1cc(CNc2ccc(S(C)(=O)=O)nc2)c(C)n1C |
| InChI | InChI=1S/C14H19N3O2S/c1-10-7-12(11(2)17(10)3)8-15-13-5-6-14(16-9-13)20(4,18)19/h5-7,9,15H,8H2,1-4H3 |
| InChIKey | KYNHVTBSNDNTKC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine?
The IUPAC name of 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine (CID 62473129) is 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine.
What is the SMILES notation for 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine?
The canonical SMILES for 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine is Cc1cc(CNc2ccc(S(C)(=O)=O)nc2)c(C)n1C.
What is the InChIKey of 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine?
The InChIKey is KYNHVTBSNDNTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S/c1-10-7-12(11(2)17(10)3)8-15-13-5-6-14(16-9-13)20(4,18)19/h5-7,9,15H,8H2,1-4H3.
What are the key properties of 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine?
6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine has a molecular weight of 293.39 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyridin-3-amine is sourced from PubChem (CID 62473129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).