About 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline
2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline (PubChem CID 62474218) has the molecular formula C15H20N2O2S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline.
Molecular Properties
| Compound Name | 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline |
| PubChem CID | 62474218 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline |
| SMILES | Cc1cc(CNc2ccccc2S(C)(=O)=O)c(C)n1C |
| InChI | InChI=1S/C15H20N2O2S/c1-11-9-13(12(2)17(11)3)10-16-14-7-5-6-8-15(14)20(4,18)19/h5-9,16H,10H2,1-4H3 |
| InChIKey | XBVHXYQHFNNBIN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline?
The IUPAC name of 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline (CID 62474218) is 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline.
What is the SMILES notation for 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline?
The canonical SMILES for 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline is Cc1cc(CNc2ccccc2S(C)(=O)=O)c(C)n1C.
What is the InChIKey of 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline?
The InChIKey is XBVHXYQHFNNBIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2S/c1-11-9-13(12(2)17(11)3)10-16-14-7-5-6-8-15(14)20(4,18)19/h5-9,16H,10H2,1-4H3.
What are the key properties of 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline?
2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline has a molecular weight of 292.40 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline is sourced from PubChem (CID 62474218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).