C15H19N3O2 — CID 62472587
2-methyl-3-nitro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline (PubChem CID 62472587) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline.
| Compound Name | 2-methyl-3-nitro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 62472587 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-methyl-3-nitro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline |
| SMILES | Cc1c(NCc2cc(C)n(C)c2C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O2/c1-10-8-13(12(3)17(10)4)9-16-14-6-5-7-15(11(14)2)18(19)20/h5-8,16H,9H2,1-4H3 |
| InChIKey | KWOQMZWLCIRPNX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|