C13H12Cl2N2O2S — CID 43675178
N-[(3,4-dichlorophenyl)methyl]-6-methylsulfonylpyridin-3-amine (PubChem CID 43675178) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-6-methylsulfonylpyridin-3-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-6-methylsulfonylpyridin-3-amine |
|---|---|
| PubChem CID | 43675178 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-6-methylsulfonylpyridin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(NCc2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C13H12Cl2N2O2S/c1-20(18,19)13-5-3-10(8-17-13)16-7-9-2-4-11(14)12(15)6-9/h2-6,8,16H,7H2,1H3 |
| InChIKey | CGOBDZRFAABWOM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |