C16H14BrN3 — CID 107797533
4-bromo-2-(2,3-dihydro-1H-indol-7-ylmethylamino)benzonitrile (PubChem CID 107797533) has the molecular formula C16H14BrN3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 4-bromo-2-(2,3-dihydro-1H-indol-7-ylmethylamino)benzonitrile.
| Compound Name | 4-bromo-2-(2,3-dihydro-1H-indol-7-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 107797533 |
| Molecular Formula | C16H14BrN3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-bromo-2-(2,3-dihydro-1H-indol-7-ylmethylamino)benzonitrile |
| SMILES | N#Cc1ccc(Br)cc1NCc1cccc2c1NCC2 |
| InChI | InChI=1S/C16H14BrN3/c17-14-5-4-12(9-18)15(8-14)20-10-13-3-1-2-11-6-7-19-16(11)13/h1-5,8,19-20H,6-7,10H2 |
| InChIKey | KHSAFSDZCHQDSV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |