C16H17BrN2 — CID 80649143
4-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-methylaniline (PubChem CID 80649143) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-methylaniline.
| Compound Name | 4-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-methylaniline |
|---|---|
| PubChem CID | 80649143 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-methylaniline |
| SMILES | Cc1cc(Br)ccc1NCc1cccc2c1NCC2 |
| InChI | InChI=1S/C16H17BrN2/c1-11-9-14(17)5-6-15(11)19-10-13-4-2-3-12-7-8-18-16(12)13/h2-6,9,18-19H,7-8,10H2,1H3 |
| InChIKey | AFOFHUQTXSOGFV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |