C14H16BN2O6S2 — CID 66974129
CID 66974129 (PubChem CID 66974129) has the molecular formula C14H16BN2O6S2 and a molecular weight of 383.24 g/mol.
| Compound Name | CID 66974129 |
|---|---|
| PubChem CID | 66974129 |
| Molecular Formula | C14H16BN2O6S2 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccccc1O[B]Oc1ccccc1CS(N)(=O)=O |
| InChI | InChI=1S/C14H16BN2O6S2/c1-24(18,19)17-12-7-3-5-9-14(12)23-15-22-13-8-4-2-6-11(13)10-25(16,20)21/h2-9,17H,10H2,1H3,(H2,16,20,21) |
| InChIKey | KXPAIPVLPPBVEM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|