C9H17Cl2NO — CID 67571488
(2,3-dimethylphenyl)methanamine;hydrate;dihydrochloride (PubChem CID 67571488) has the molecular formula C9H17Cl2NO and a molecular weight of 226.15 g/mol. Its IUPAC name is (2,3-dimethylphenyl)methanamine;hydrate;dihydrochloride.
| Compound Name | (2,3-dimethylphenyl)methanamine;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 67571488 |
| Molecular Formula | C9H17Cl2NO |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | (2,3-dimethylphenyl)methanamine;hydrate;dihydrochloride |
| SMILES | Cc1cccc(CN)c1C.Cl.Cl.O |
| InChI | InChI=1S/C9H13N.2ClH.H2O/c1-7-4-3-5-9(6-10)8(7)2;;;/h3-5H,6,10H2,1-2H3;2*1H;1H2 |
| InChIKey | QAEZYIQWDLIBHY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |