C8H9F2N — CID 11469203
(2,4-difluoro-3-methylphenyl)methanamine (PubChem CID 11469203) has the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. Its IUPAC name is (2,4-difluoro-3-methylphenyl)methanamine.
| Compound Name | (2,4-difluoro-3-methylphenyl)methanamine |
|---|---|
| PubChem CID | 11469203 |
| Molecular Formula | C8H9F2N |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (2,4-difluoro-3-methylphenyl)methanamine |
| SMILES | Cc1c(F)ccc(CN)c1F |
| InChI | InChI=1S/C8H9F2N/c1-5-7(9)3-2-6(4-11)8(5)10/h2-3H,4,11H2,1H3 |
| InChIKey | LPMVSOQQHWTDRH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |