C7H6BrF2N — CID 66820102
(4-bromo-2,3-difluorophenyl)methanamine (PubChem CID 66820102) has the molecular formula C7H6BrF2N and a molecular weight of 222.03 g/mol. Its IUPAC name is (4-bromo-2,3-difluorophenyl)methanamine.
| Compound Name | (4-bromo-2,3-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 66820102 |
| Molecular Formula | C7H6BrF2N |
| Molecular Weight | 222.03 g/mol |
| Exact Mass | 220.97 |
| IUPAC Name | (4-bromo-2,3-difluorophenyl)methanamine |
| SMILES | NCc1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C7H6BrF2N/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2H,3,11H2 |
| InChIKey | SDJRJURTLACTFQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.03 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|