C10H9BrF2 — CID 175075918
1-bromo-4-but-2-enyl-2,3-difluorobenzene (PubChem CID 175075918) has the molecular formula C10H9BrF2 and a molecular weight of 247.08 g/mol. Its IUPAC name is 1-bromo-4-but-2-enyl-2,3-difluorobenzene.
| Compound Name | 1-bromo-4-but-2-enyl-2,3-difluorobenzene |
|---|---|
| PubChem CID | 175075918 |
| Molecular Formula | C10H9BrF2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 1-bromo-4-but-2-enyl-2,3-difluorobenzene |
| SMILES | CC=CCc1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C10H9BrF2/c1-2-3-4-7-5-6-8(11)10(13)9(7)12/h2-3,5-6H,4H2,1H3 |
| InChIKey | DNBSSNOPFGJOBY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|