C13H9BrF2O — CID 67434406
1-bromo-2,3-difluoro-4-(phenoxymethyl)benzene (PubChem CID 67434406) has the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. Its IUPAC name is 1-bromo-2,3-difluoro-4-(phenoxymethyl)benzene.
| Compound Name | 1-bromo-2,3-difluoro-4-(phenoxymethyl)benzene |
|---|---|
| PubChem CID | 67434406 |
| Molecular Formula | C13H9BrF2O |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 1-bromo-2,3-difluoro-4-(phenoxymethyl)benzene |
| SMILES | Fc1c(Br)ccc(COc2ccccc2)c1F |
| InChI | InChI=1S/C13H9BrF2O/c14-11-7-6-9(12(15)13(11)16)8-17-10-4-2-1-3-5-10/h1-7H,8H2 |
| InChIKey | LDSLLHLBSRBPIS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|