C22H22F4 — CID 57063698
1-but-2-enyl-4-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluorobenzene (PubChem CID 57063698) has the molecular formula C22H22F4 and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-but-2-enyl-4-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluorobenzene.
| Compound Name | 1-but-2-enyl-4-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 57063698 |
| Molecular Formula | C22H22F4 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-but-2-enyl-4-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluorobenzene |
| SMILES | CC=CCc1ccc(-c2ccc(C3CCC(F)(F)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C22H22F4/c1-2-3-4-18-9-10-19(21(24)20(18)23)17-7-5-15(6-8-17)16-11-13-22(25,26)14-12-16/h2-3,5-10,16H,4,11-14H2,1H3 |
| InChIKey | QLLCYJJTUFYBNB-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|