C29H27F5 — CID 118858785
2,3-difluoro-1-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene (PubChem CID 118858785) has the molecular formula C29H27F5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene.
| Compound Name | 2,3-difluoro-1-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 118858785 |
| Molecular Formula | C29H27F5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2,3-difluoro-1-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(CCc4cc(F)c(F)c(F)c4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C29H27F5/c1-2-3-18-4-7-20(8-5-18)21-10-12-22(13-11-21)24-15-14-23(27(32)28(24)33)9-6-19-16-25(30)29(34)26(31)17-19/h2-3,10-18,20H,4-9H2,1H3/b3-2+ |
| InChIKey | XRVLQTDOUNYTGZ-NSCUHMNNSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|