C27H25F5 — CID 118858786
2,3-difluoro-1-[4-(4-methylcyclohexyl)phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene (PubChem CID 118858786) has the molecular formula C27H25F5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(4-methylcyclohexyl)phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene.
| Compound Name | 2,3-difluoro-1-[4-(4-methylcyclohexyl)phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 118858786 |
| Molecular Formula | C27H25F5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2,3-difluoro-1-[4-(4-methylcyclohexyl)phenyl]-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene |
| SMILES | CC1CCC(c2ccc(-c3ccc(CCc4cc(F)c(F)c(F)c4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C27H25F5/c1-16-2-5-18(6-3-16)19-8-10-20(11-9-19)22-13-12-21(25(30)26(22)31)7-4-17-14-23(28)27(32)24(29)15-17/h8-16,18H,2-7H2,1H3 |
| InChIKey | UZXHJEMITWUYLV-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|