C29H29F3 — CID 143772631
1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]benzene (PubChem CID 143772631) has the molecular formula C29H29F3 and a molecular weight of 434.55 g/mol. Its IUPAC name is 1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]benzene.
| Compound Name | 1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 143772631 |
| Molecular Formula | C29H29F3 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]benzene |
| SMILES | C/C=C\Cc1ccc(-c2ccc(-c3ccc(C4CCC(C)CC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C29H29F3/c1-3-4-5-23-14-17-26(29(32)28(23)31)22-12-10-21(11-13-22)25-16-15-24(18-27(25)30)20-8-6-19(2)7-9-20/h3-4,10-20H,5-9H2,1-2H3/b4-3- |
| InChIKey | FSNVTVQPCTYPOO-ARJAWSKDSA-N |
| XLogP | 8.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|