C23H24ClFO — CID 89046706
2-[2-chloro-3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]phenyl]oxirane (PubChem CID 89046706) has the molecular formula C23H24ClFO and a molecular weight of 370.90 g/mol. Its IUPAC name is 2-[2-chloro-3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]phenyl]oxirane.
| Compound Name | 2-[2-chloro-3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89046706 |
| Molecular Formula | C23H24ClFO |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[2-chloro-3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]phenyl]oxirane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(C4CO4)c(Cl)c3F)cc2)CC1 |
| InChI | InChI=1S/C23H24ClFO/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-13-20(21-14-26-21)22(24)23(19)25/h2-3,8-13,15-16,21H,4-7,14H2,1H3/b3-2+ |
| InChIKey | FJRVVMUOGKWPOH-NSCUHMNNSA-N |
| XLogP | 7.07 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|