C21H22ClFO — CID 89145667
2-[3-chloro-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]oxirane (PubChem CID 89145667) has the molecular formula C21H22ClFO and a molecular weight of 344.86 g/mol. Its IUPAC name is 2-[3-chloro-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]oxirane.
| Compound Name | 2-[3-chloro-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89145667 |
| Molecular Formula | C21H22ClFO |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[3-chloro-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]oxirane |
| SMILES | CC1CCC(c2ccc(-c3ccc(C4CO4)c(F)c3Cl)cc2)CC1 |
| InChI | InChI=1S/C21H22ClFO/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)17-10-11-18(19-12-24-19)21(23)20(17)22/h6-11,13-14,19H,2-5,12H2,1H3 |
| InChIKey | OJXVALBWGLHYHQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|