C19H19ClFRb — CID 58058767
3-chloro-2-fluoro-1-(4-methylcyclohexyl)-4-phenylbenzene;rubidium(1+) (PubChem CID 58058767) has the molecular formula C19H19ClFRb and a molecular weight of 387.28 g/mol. Its IUPAC name is 3-chloro-2-fluoro-1-(4-methylcyclohexyl)-4-phenylbenzene;rubidium(1+).
| Compound Name | 3-chloro-2-fluoro-1-(4-methylcyclohexyl)-4-phenylbenzene;rubidium(1+) |
|---|---|
| PubChem CID | 58058767 |
| Molecular Formula | C19H19ClFRb |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 3-chloro-2-fluoro-1-(4-methylcyclohexyl)-4-phenylbenzene;rubidium(1+) |
| SMILES | CC1CCC(c2ccc(-c3cc[c-]cc3)c(Cl)c2F)CC1.[Rb+] |
| InChI | InChI=1S/C19H19ClF.Rb/c1-13-7-9-15(10-8-13)17-12-11-16(18(20)19(17)21)14-5-3-2-4-6-14;/h3-6,11-13,15H,7-10H2,1H3;/q-1;+1 |
| InChIKey | KHRNZNMWHRLLAP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|