C32H34F2O — CID 88861166
2-[4-[4-[4-[(E)-4-(4-ethylphenyl)but-1-enyl]cyclohexyl]phenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88861166) has the molecular formula C32H34F2O and a molecular weight of 472.62 g/mol. Its IUPAC name is 2-[4-[4-[4-[(E)-4-(4-ethylphenyl)but-1-enyl]cyclohexyl]phenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[4-[(E)-4-(4-ethylphenyl)but-1-enyl]cyclohexyl]phenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88861166 |
| Molecular Formula | C32H34F2O |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[4-[4-[4-[(E)-4-(4-ethylphenyl)but-1-enyl]cyclohexyl]phenyl]-2,3-difluorophenyl]oxirane |
| SMILES | CCc1ccc(CC/C=C/C2CCC(c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H34F2O/c1-2-22-7-9-23(10-8-22)5-3-4-6-24-11-13-25(14-12-24)26-15-17-27(18-16-26)28-19-20-29(30-21-35-30)32(34)31(28)33/h4,6-10,15-20,24-25,30H,2-3,5,11-14,21H2,1H3/b6-4+ |
| InChIKey | AKJASVBSOIXSND-GQCTYLIASA-N |
| XLogP | 8.73 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|