C30H36ClFO2 — CID 89077064
2-[3-chloro-2-fluoro-4-[4-[[4-(4-propylcyclohexyl)phenoxy]methyl]cyclohexen-1-yl]phenyl]oxirane (PubChem CID 89077064) has the molecular formula C30H36ClFO2 and a molecular weight of 483.07 g/mol. Its IUPAC name is 2-[3-chloro-2-fluoro-4-[4-[[4-(4-propylcyclohexyl)phenoxy]methyl]cyclohexen-1-yl]phenyl]oxirane.
| Compound Name | 2-[3-chloro-2-fluoro-4-[4-[[4-(4-propylcyclohexyl)phenoxy]methyl]cyclohexen-1-yl]phenyl]oxirane |
|---|---|
| PubChem CID | 89077064 |
| Molecular Formula | C30H36ClFO2 |
| Molecular Weight | 483.07 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-[3-chloro-2-fluoro-4-[4-[[4-(4-propylcyclohexyl)phenoxy]methyl]cyclohexen-1-yl]phenyl]oxirane |
| SMILES | CCCC1CCC(c2ccc(OCC3CC=C(c4ccc(C5CO5)c(F)c4Cl)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H36ClFO2/c1-2-3-20-4-8-22(9-5-20)23-12-14-25(15-13-23)33-18-21-6-10-24(11-7-21)26-16-17-27(28-19-34-28)30(32)29(26)31/h10,12-17,20-22,28H,2-9,11,18-19H2,1H3 |
| InChIKey | ZAEIVJZXCRAZFG-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.07 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|