C22H23ClFNO — CID 89077030
5-[2-chloro-3-fluoro-4-(oxiran-2-yl)phenyl]-2-(4-propylcyclohexen-1-yl)pyridine (PubChem CID 89077030) has the molecular formula C22H23ClFNO and a molecular weight of 371.88 g/mol. Its IUPAC name is 5-[2-chloro-3-fluoro-4-(oxiran-2-yl)phenyl]-2-(4-propylcyclohexen-1-yl)pyridine.
| Compound Name | 5-[2-chloro-3-fluoro-4-(oxiran-2-yl)phenyl]-2-(4-propylcyclohexen-1-yl)pyridine |
|---|---|
| PubChem CID | 89077030 |
| Molecular Formula | C22H23ClFNO |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 5-[2-chloro-3-fluoro-4-(oxiran-2-yl)phenyl]-2-(4-propylcyclohexen-1-yl)pyridine |
| SMILES | CCCC1CC=C(c2ccc(-c3ccc(C4CO4)c(F)c3Cl)cn2)CC1 |
| InChI | InChI=1S/C22H23ClFNO/c1-2-3-14-4-6-15(7-5-14)19-11-8-16(12-25-19)17-9-10-18(20-13-26-20)22(24)21(17)23/h6,8-12,14,20H,2-5,7,13H2,1H3 |
| InChIKey | WOHVHYDKOOHSFE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|