C25H29ClFNO2 — CID 59257074
5-[2-chloro-3-fluoro-4-[4-(5-methyloxan-2-yl)cyclohexen-1-yl]phenyl]-2-ethoxypyridine (PubChem CID 59257074) has the molecular formula C25H29ClFNO2 and a molecular weight of 429.96 g/mol. Its IUPAC name is 5-[2-chloro-3-fluoro-4-[4-(5-methyloxan-2-yl)cyclohexen-1-yl]phenyl]-2-ethoxypyridine.
| Compound Name | 5-[2-chloro-3-fluoro-4-[4-(5-methyloxan-2-yl)cyclohexen-1-yl]phenyl]-2-ethoxypyridine |
|---|---|
| PubChem CID | 59257074 |
| Molecular Formula | C25H29ClFNO2 |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 5-[2-chloro-3-fluoro-4-[4-(5-methyloxan-2-yl)cyclohexen-1-yl]phenyl]-2-ethoxypyridine |
| SMILES | CCOc1ccc(-c2ccc(C3=CCC(C4CCC(C)CO4)CC3)c(F)c2Cl)cn1 |
| InChI | InChI=1S/C25H29ClFNO2/c1-3-29-23-13-9-19(14-28-23)20-10-11-21(25(27)24(20)26)17-5-7-18(8-6-17)22-12-4-16(2)15-30-22/h5,9-11,13-14,16,18,22H,3-4,6-8,12,15H2,1-2H3 |
| InChIKey | RZYXYHBVBGXEPI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |