C26H36ClFO — CID 70842884
5-[4-[3-chloro-4-(4-ethylcyclohexyl)-2-fluorophenyl]cyclohex-3-en-1-yl]-2-methyloxane (PubChem CID 70842884) has the molecular formula C26H36ClFO and a molecular weight of 419.02 g/mol. Its IUPAC name is 5-[4-[3-chloro-4-(4-ethylcyclohexyl)-2-fluorophenyl]cyclohex-3-en-1-yl]-2-methyloxane.
| Compound Name | 5-[4-[3-chloro-4-(4-ethylcyclohexyl)-2-fluorophenyl]cyclohex-3-en-1-yl]-2-methyloxane |
|---|---|
| PubChem CID | 70842884 |
| Molecular Formula | C26H36ClFO |
| Molecular Weight | 419.02 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 5-[4-[3-chloro-4-(4-ethylcyclohexyl)-2-fluorophenyl]cyclohex-3-en-1-yl]-2-methyloxane |
| SMILES | CCC1CCC(c2ccc(C3=CCC(C4CCC(C)OC4)CC3)c(F)c2Cl)CC1 |
| InChI | InChI=1S/C26H36ClFO/c1-3-18-5-8-20(9-6-18)23-14-15-24(26(28)25(23)27)21-12-10-19(11-13-21)22-7-4-17(2)29-16-22/h12,14-15,17-20,22H,3-11,13,16H2,1-2H3 |
| InChIKey | LSFCNJBWWMMSAS-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.02 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |