C29H39F2 — CID 176956699
CID 176956699 (PubChem CID 176956699) has the molecular formula C29H39F2 and a molecular weight of 425.63 g/mol.
| Compound Name | CID 176956699 |
|---|---|
| PubChem CID | 176956699 |
| Molecular Formula | C29H39F2 |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | — |
| SMILES | C#Cc1ccc(C2=CCC(C3CCC(CC)CC3)CC2)c(F)c1F.[CH2]CC1CCCC1 |
| InChI | InChI=1S/C22H26F2.C7H13/c1-3-15-5-7-17(8-6-15)18-9-11-19(12-10-18)20-14-13-16(4-2)21(23)22(20)24;1-2-7-5-3-4-6-7/h2,11,13-15,17-18H,3,5-10,12H2,1H3;7H,1-6H2 |
| InChIKey | PGRPFXIZQYLQJO-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|