C24H31F2 — CID 176956706
CID 176956706 (PubChem CID 176956706) has the molecular formula C24H31F2 and a molecular weight of 357.51 g/mol.
| Compound Name | CID 176956706 |
|---|---|
| PubChem CID | 176956706 |
| Molecular Formula | C24H31F2 |
| Molecular Weight | 357.51 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | — |
| SMILES | C#Cc1ccc(C2=CCC(CCCC)CC2)c(F)c1F.[CH2]C1CCCC1 |
| InChI | InChI=1S/C18H20F2.C6H11/c1-3-5-6-13-7-9-15(10-8-13)16-12-11-14(4-2)17(19)18(16)20;1-6-4-2-3-5-6/h2,9,11-13H,3,5-8,10H2,1H3;6H,1-5H2 |
| InChIKey | UTMGXFZLVUMMAI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|