C33H34F4 — CID 67732093
1-(4-butylcyclohexen-1-yl)-4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorobenzene (PubChem CID 67732093) has the molecular formula C33H34F4 and a molecular weight of 506.63 g/mol. Its IUPAC name is 1-(4-butylcyclohexen-1-yl)-4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-butylcyclohexen-1-yl)-4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67732093 |
| Molecular Formula | C33H34F4 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 1-(4-butylcyclohexen-1-yl)-4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-2,3-difluorobenzene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(-c3ccc(C4=CCC(CCCC)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C33H34F4/c1-3-5-7-9-26-18-19-27(31(35)30(26)34)24-14-16-25(17-15-24)29-21-20-28(32(36)33(29)37)23-12-10-22(11-13-23)8-6-4-2/h3,5,12,14-22H,4,6-11,13H2,1-2H3/b5-3+ |
| InChIKey | SATPQIVEQRPHIA-HWKANZROSA-N |
| XLogP | 10.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|