C22H28ClFO2 — CID 89077083
2-[4-[3-chloro-2-fluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]-5-propyloxane (PubChem CID 89077083) has the molecular formula C22H28ClFO2 and a molecular weight of 378.92 g/mol. Its IUPAC name is 2-[4-[3-chloro-2-fluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]-5-propyloxane.
| Compound Name | 2-[4-[3-chloro-2-fluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]-5-propyloxane |
|---|---|
| PubChem CID | 89077083 |
| Molecular Formula | C22H28ClFO2 |
| Molecular Weight | 378.92 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[4-[3-chloro-2-fluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]-5-propyloxane |
| SMILES | CCCC1CCC(C2CC=C(c3ccc(C4CO4)c(Cl)c3F)CC2)OC1 |
| InChI | InChI=1S/C22H28ClFO2/c1-2-3-14-4-11-19(25-12-14)16-7-5-15(6-8-16)17-9-10-18(20-13-26-20)21(23)22(17)24/h5,9-10,14,16,19-20H,2-4,6-8,11-13H2,1H3 |
| InChIKey | PRRPXZONKVUGQD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.92 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|