C23H30ClFO — CID 141281492
3-chloro-1-ethoxy-2-fluoro-4-[4-(4-propylcyclohex-3-en-1-yl)cyclohexen-1-yl]benzene (PubChem CID 141281492) has the molecular formula C23H30ClFO and a molecular weight of 376.94 g/mol. Its IUPAC name is 3-chloro-1-ethoxy-2-fluoro-4-[4-(4-propylcyclohex-3-en-1-yl)cyclohexen-1-yl]benzene.
| Compound Name | 3-chloro-1-ethoxy-2-fluoro-4-[4-(4-propylcyclohex-3-en-1-yl)cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 141281492 |
| Molecular Formula | C23H30ClFO |
| Molecular Weight | 376.94 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-chloro-1-ethoxy-2-fluoro-4-[4-(4-propylcyclohex-3-en-1-yl)cyclohexen-1-yl]benzene |
| SMILES | CCCC1=CCC(C2CC=C(c3ccc(OCC)c(F)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C23H30ClFO/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-15-21(26-4-2)23(25)22(20)24/h6,12,14-15,17-18H,3-5,7-11,13H2,1-2H3 |
| InChIKey | PHAZMXCBCBQAMC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.94 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|