C28H30F4O — CID 166704296
2-[4-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-(3-methylcyclobutyl)oxane (PubChem CID 166704296) has the molecular formula C28H30F4O and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-[4-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-(3-methylcyclobutyl)oxane.
| Compound Name | 2-[4-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-(3-methylcyclobutyl)oxane |
|---|---|
| PubChem CID | 166704296 |
| Molecular Formula | C28H30F4O |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-[4-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-(3-methylcyclobutyl)oxane |
| SMILES | CC1CC(C2CCC(C3CC=C(c4ccc(-c5ccc(F)c(F)c5F)c(F)c4)CC3)OC2)C1 |
| InChI | InChI=1S/C28H30F4O/c1-16-12-21(13-16)20-7-11-26(33-15-20)18-4-2-17(3-5-18)19-6-8-22(25(30)14-19)23-9-10-24(29)28(32)27(23)31/h2,6,8-10,14,16,18,20-21,26H,3-5,7,11-13,15H2,1H3 |
| InChIKey | YPMGOLKRPQFLBI-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|