C32H42F4O2 — CID 156564860
2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-propyl-1,3-dioxane;heptane (PubChem CID 156564860) has the molecular formula C32H42F4O2 and a molecular weight of 534.68 g/mol. Its IUPAC name is 2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-propyl-1,3-dioxane;heptane.
| Compound Name | 2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-propyl-1,3-dioxane;heptane |
|---|---|
| PubChem CID | 156564860 |
| Molecular Formula | C32H42F4O2 |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohex-3-en-1-yl]-5-propyl-1,3-dioxane;heptane |
| SMILES | CCCC1COC(C2CC=C(c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)CC2)OC1.CCCCCCC |
| InChI | InChI=1S/C25H26F4O2.C7H16/c1-2-3-15-13-30-25(31-14-15)17-6-4-16(5-7-17)18-8-9-20(21(26)10-18)19-11-22(27)24(29)23(28)12-19;1-3-5-7-6-4-2/h4,8-12,15,17,25H,2-3,5-7,13-14H2,1H3;3-7H2,1-2H3 |
| InChIKey | YZPHVUJSARIRIM-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|