C23H31F3O2 — CID 167341454
5-hexyl-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane (PubChem CID 167341454) has the molecular formula C23H31F3O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-hexyl-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane.
| Compound Name | 5-hexyl-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 167341454 |
| Molecular Formula | C23H31F3O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 5-hexyl-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
| SMILES | CCCCCCC1COC(C2CC=C(c3ccc(C(F)(F)F)cc3)CC2)OC1 |
| InChI | InChI=1S/C23H31F3O2/c1-2-3-4-5-6-17-15-27-22(28-16-17)20-9-7-18(8-10-20)19-11-13-21(14-12-19)23(24,25)26/h7,11-14,17,20,22H,2-6,8-10,15-16H2,1H3 |
| InChIKey | OZGHVSLOBRJUJB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|