C28H23F5O2 — CID 88967531
1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]ethanol (PubChem CID 88967531) has the molecular formula C28H23F5O2 and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]ethanol.
| Compound Name | 1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]ethanol |
|---|---|
| PubChem CID | 88967531 |
| Molecular Formula | C28H23F5O2 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]ethanol |
| SMILES | CC(O)c1ccc(C2CC=C(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C28H23F5O2/c1-14(34)18-8-9-19(26(31)25(18)30)16-4-2-15(3-5-16)17-6-7-20(23(29)12-17)21-10-11-22(24-13-35-24)28(33)27(21)32/h2,6-12,14,16,24,34H,3-5,13H2,1H3 |
| InChIKey | WMLVKEMGMSUPSB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|