C29H23F5O4 — CID 88967718
[2,3-difluoro-4-(1-hydroxyethyl)phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2-fluorophenyl]cyclohex-3-ene-1-carboxylate (PubChem CID 88967718) has the molecular formula C29H23F5O4 and a molecular weight of 530.49 g/mol. Its IUPAC name is [2,3-difluoro-4-(1-hydroxyethyl)phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2-fluorophenyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | [2,3-difluoro-4-(1-hydroxyethyl)phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2-fluorophenyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 88967718 |
| Molecular Formula | C29H23F5O4 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | [2,3-difluoro-4-(1-hydroxyethyl)phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2-fluorophenyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC(O)c1ccc(OC(=O)C2CC=C(c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3F)CC2)c(F)c1F |
| InChI | InChI=1S/C29H23F5O4/c1-14(35)18-10-11-23(28(34)25(18)31)38-29(36)16-4-2-15(3-5-16)19-7-6-17(12-22(19)30)20-8-9-21(24-13-37-24)27(33)26(20)32/h2,6-12,14,16,24,35H,3-5,13H2,1H3 |
| InChIKey | QETCIQVXVKQXKI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|