C29H27F3O4 — CID 89124855
[2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate (PubChem CID 89124855) has the molecular formula C29H27F3O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is [2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | [2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89124855 |
| Molecular Formula | C29H27F3O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate |
| SMILES | CC(O)c1ccc(-c2ccc(OC(=O)C3CCC(c4ccc(C5CO5)c(F)c4)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C29H27F3O4/c1-16(33)17-2-6-19(7-3-17)22-12-13-25(28(32)27(22)31)36-29(34)20-8-4-18(5-9-20)21-10-11-23(24(30)14-21)26-15-35-26/h2-3,6-7,10-14,16,18,20,26,33H,4-5,8-9,15H2,1H3 |
| InChIKey | YGSGNMIZANNRGC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|