C26H19F5O4 — CID 89046000
[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl] 5-fluorooxane-2-carboxylate (PubChem CID 89046000) has the molecular formula C26H19F5O4 and a molecular weight of 490.42 g/mol. Its IUPAC name is [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl] 5-fluorooxane-2-carboxylate.
| Compound Name | [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl] 5-fluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 89046000 |
| Molecular Formula | C26H19F5O4 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl] 5-fluorooxane-2-carboxylate |
| SMILES | O=C(Oc1ccc(-c2ccc(-c3ccc(C4CO4)c(F)c3F)cc2)c(F)c1F)C1CCC(F)CO1 |
| InChI | InChI=1S/C26H19F5O4/c27-15-5-9-20(33-11-15)26(32)35-19-10-8-17(23(29)25(19)31)14-3-1-13(2-4-14)16-6-7-18(21-12-34-21)24(30)22(16)28/h1-4,6-8,10,15,20-21H,5,9,11-12H2 |
| InChIKey | WEAGVFAADQCLCE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|