C29H31F3O3 — CID 88953335
[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl] 4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate (PubChem CID 88953335) has the molecular formula C29H31F3O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is [4-(4-ethenylcyclohexyl)-2,3-difluorophenyl] 4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | [4-(4-ethenylcyclohexyl)-2,3-difluorophenyl] 4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88953335 |
| Molecular Formula | C29H31F3O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [4-(4-ethenylcyclohexyl)-2,3-difluorophenyl] 4-[2-fluoro-4-(oxiran-2-yl)phenyl]cyclohexane-1-carboxylate |
| SMILES | C=CC1CCC(c2ccc(OC(=O)C3CCC(c4ccc(C5CO5)cc4F)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H31F3O3/c1-2-17-3-5-19(6-4-17)23-13-14-25(28(32)27(23)31)35-29(33)20-9-7-18(8-10-20)22-12-11-21(15-24(22)30)26-16-34-26/h2,11-15,17-20,26H,1,3-10,16H2 |
| InChIKey | MOHKHLJAEYDVJD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|