C23H20ClFO — CID 89145644
2-[3-chloro-2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]oxirane (PubChem CID 89145644) has the molecular formula C23H20ClFO and a molecular weight of 366.86 g/mol. Its IUPAC name is 2-[3-chloro-2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]oxirane.
| Compound Name | 2-[3-chloro-2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89145644 |
| Molecular Formula | C23H20ClFO |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[3-chloro-2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]oxirane |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(C4CO4)c(F)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C23H20ClFO/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-13-20(21-14-26-21)23(25)22(19)24/h4-13,21H,2-3,14H2,1H3 |
| InChIKey | XICQVPGMTOXBPV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|