C27H26F5NO — CID 89009278
2-fluoro-6-[4-[3-fluoro-4-(oxiran-2-yl)-2-(trifluoromethyl)phenyl]butyl]-3-(4-propylphenyl)pyridine (PubChem CID 89009278) has the molecular formula C27H26F5NO and a molecular weight of 475.50 g/mol. Its IUPAC name is 2-fluoro-6-[4-[3-fluoro-4-(oxiran-2-yl)-2-(trifluoromethyl)phenyl]butyl]-3-(4-propylphenyl)pyridine.
| Compound Name | 2-fluoro-6-[4-[3-fluoro-4-(oxiran-2-yl)-2-(trifluoromethyl)phenyl]butyl]-3-(4-propylphenyl)pyridine |
|---|---|
| PubChem CID | 89009278 |
| Molecular Formula | C27H26F5NO |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-fluoro-6-[4-[3-fluoro-4-(oxiran-2-yl)-2-(trifluoromethyl)phenyl]butyl]-3-(4-propylphenyl)pyridine |
| SMILES | CCCc1ccc(-c2ccc(CCCCc3ccc(C4CO4)c(F)c3C(F)(F)F)nc2F)cc1 |
| InChI | InChI=1S/C27H26F5NO/c1-2-5-17-8-10-18(11-9-17)21-15-13-20(33-26(21)29)7-4-3-6-19-12-14-22(23-16-34-23)25(28)24(19)27(30,31)32/h8-15,23H,2-7,16H2,1H3 |
| InChIKey | YZDMHLSFRRFXOH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|