C23H19Cl2F3 — CID 118858550
2,3-dichloro-1-(4-propylphenyl)-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene (PubChem CID 118858550) has the molecular formula C23H19Cl2F3 and a molecular weight of 423.31 g/mol. Its IUPAC name is 2,3-dichloro-1-(4-propylphenyl)-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene.
| Compound Name | 2,3-dichloro-1-(4-propylphenyl)-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 118858550 |
| Molecular Formula | C23H19Cl2F3 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2,3-dichloro-1-(4-propylphenyl)-4-[2-(3,4,5-trifluorophenyl)ethyl]benzene |
| SMILES | CCCc1ccc(-c2ccc(CCc3cc(F)c(F)c(F)c3)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C23H19Cl2F3/c1-2-3-14-4-7-16(8-5-14)18-11-10-17(21(24)22(18)25)9-6-15-12-19(26)23(28)20(27)13-15/h4-5,7-8,10-13H,2-3,6,9H2,1H3 |
| InChIKey | OLASQASWOYPAHP-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|