C25H23ClF4 — CID 139758575
2-chloro-5-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]phenyl]ethyl]-1,3-difluorobenzene (PubChem CID 139758575) has the molecular formula C25H23ClF4 and a molecular weight of 434.90 g/mol. Its IUPAC name is 2-chloro-5-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]phenyl]ethyl]-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]phenyl]ethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 139758575 |
| Molecular Formula | C25H23ClF4 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-chloro-5-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]phenyl]ethyl]-1,3-difluorobenzene |
| SMILES | CCCc1cc(F)c(CCc2ccc(CCc3cc(F)c(Cl)c(F)c3)cc2)c(F)c1 |
| InChI | InChI=1S/C25H23ClF4/c1-2-3-18-12-21(27)20(22(28)13-18)11-10-17-6-4-16(5-7-17)8-9-19-14-23(29)25(26)24(30)15-19/h4-7,12-15H,2-3,8-11H2,1H3 |
| InChIKey | OLGRBWPAVBNWTQ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|