C10H11BrF2 — CID 142578213
2-(bromomethyl)-1,3-difluoro-5-propylbenzene (PubChem CID 142578213) has the molecular formula C10H11BrF2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-difluoro-5-propylbenzene.
| Compound Name | 2-(bromomethyl)-1,3-difluoro-5-propylbenzene |
|---|---|
| PubChem CID | 142578213 |
| Molecular Formula | C10H11BrF2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-(bromomethyl)-1,3-difluoro-5-propylbenzene |
| SMILES | CCCc1cc(F)c(CBr)c(F)c1 |
| InChI | InChI=1S/C10H11BrF2/c1-2-3-7-4-9(12)8(6-11)10(13)5-7/h4-5H,2-3,6H2,1H3 |
| InChIKey | NHMJSNJVUQDQRG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|