C9H11F2N — CID 19781718
2,6-difluoro-4-propylaniline (PubChem CID 19781718) has the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. Its IUPAC name is 2,6-difluoro-4-propylaniline.
| Compound Name | 2,6-difluoro-4-propylaniline |
|---|---|
| PubChem CID | 19781718 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2,6-difluoro-4-propylaniline |
| SMILES | CCCc1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C9H11F2N/c1-2-3-6-4-7(10)9(12)8(11)5-6/h4-5H,2-3,12H2,1H3 |
| InChIKey | OFONOIJLLPQEGV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|