C12H18FN — CID 137443416
4-fluoro-2,6-dipropylaniline (PubChem CID 137443416) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 4-fluoro-2,6-dipropylaniline.
| Compound Name | 4-fluoro-2,6-dipropylaniline |
|---|---|
| PubChem CID | 137443416 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-fluoro-2,6-dipropylaniline |
| SMILES | CCCc1cc(F)cc(CCC)c1N |
| InChI | InChI=1S/C12H18FN/c1-3-5-9-7-11(13)8-10(6-4-2)12(9)14/h7-8H,3-6,14H2,1-2H3 |
| InChIKey | ZRSBJKZSNAZKCT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|