C24H36N2O — CID 22061802
4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline (PubChem CID 22061802) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline.
| Compound Name | 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline |
|---|---|
| PubChem CID | 22061802 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline |
| SMILES | CCCc1cc(Oc2cc(CCC)c(N)c(CCC)c2)cc(CCC)c1N |
| InChI | InChI=1S/C24H36N2O/c1-5-9-17-13-21(14-18(10-6-2)23(17)25)27-22-15-19(11-7-3)24(26)20(16-22)12-8-4/h13-16H,5-12,25-26H2,1-4H3 |
| InChIKey | MSRCYIZIQFPBJG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|