About 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline
4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline (PubChem CID 22061802) has the molecular formula C24H36N2O
and a molecular weight of 368.57 g/mol. Its IUPAC name is 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline.
Molecular Properties
| Compound Name | 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline |
| PubChem CID | 22061802 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline |
| SMILES | CCCc1cc(Oc2cc(CCC)c(N)c(CCC)c2)cc(CCC)c1N |
| InChI | InChI=1S/C24H36N2O/c1-5-9-17-13-21(14-18(10-6-2)23(17)25)27-22-15-19(11-7-3)24(26)20(16-22)12-8-4/h13-16H,5-12,25-26H2,1-4H3 |
| InChIKey | MSRCYIZIQFPBJG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline?
The IUPAC name of 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline (CID 22061802) is 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline.
What is the SMILES notation for 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline?
The canonical SMILES for 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline is CCCc1cc(Oc2cc(CCC)c(N)c(CCC)c2)cc(CCC)c1N.
What is the InChIKey of 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline?
The InChIKey is MSRCYIZIQFPBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36N2O/c1-5-9-17-13-21(14-18(10-6-2)23(17)25)27-22-15-19(11-7-3)24(26)20(16-22)12-8-4/h13-16H,5-12,25-26H2,1-4H3.
What are the key properties of 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline?
4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline has a molecular weight of 368.57 g/mol, XLogP of 6.45, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3,5-dipropylphenoxy)-2,6-dipropylaniline is sourced from PubChem (CID 22061802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).