C9H11BF2O2 — CID 19783701
(2,6-difluoro-4-propylphenyl)boronic acid (PubChem CID 19783701) has the molecular formula C9H11BF2O2 and a molecular weight of 199.99 g/mol. Its IUPAC name is (2,6-difluoro-4-propylphenyl)boronic acid.
| Compound Name | (2,6-difluoro-4-propylphenyl)boronic acid |
|---|---|
| PubChem CID | 19783701 |
| Molecular Formula | C9H11BF2O2 |
| Molecular Weight | 199.99 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (2,6-difluoro-4-propylphenyl)boronic acid |
| SMILES | CCCc1cc(F)c(B(O)O)c(F)c1 |
| InChI | InChI=1S/C9H11BF2O2/c1-2-3-6-4-7(11)9(10(13)14)8(12)5-6/h4-5,13-14H,2-3H2,1H3 |
| InChIKey | MGAVQINVJUZEGY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.99 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|